C24H26ClN3O — CID 163331868
1-[(2-methylphenyl)methyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine chloride (PubChem CID 163331868) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine chloride.
| Compound Name | 1-[(2-methylphenyl)methyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine chloride |
|---|---|
| PubChem CID | 163331868 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-3-(3-phenoxypropyl)benzimidazol-1-ium-2-amine chloride |
| SMILES | Cc1ccccc1C[n+]1c(N)n(CCCOc2ccccc2)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C24H25N3O.ClH/c1-19-10-5-6-11-20(19)18-27-23-15-8-7-14-22(23)26(24(27)25)16-9-17-28-21-12-3-2-4-13-21;/h2-8,10-15,25H,9,16-18H2,1H3;1H |
| InChIKey | WHDBGNJELOQQEK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|