C23H24N3O2+ — CID 7093397
(2S)-1-(2-amino-3-benzylbenzimidazol-3-ium-1-yl)-3-phenoxypropan-2-ol (PubChem CID 7093397) has the molecular formula C23H24N3O2+ and a molecular weight of 374.46 g/mol. Its IUPAC name is (2S)-1-(2-amino-3-benzylbenzimidazol-3-ium-1-yl)-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-(2-amino-3-benzylbenzimidazol-3-ium-1-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 7093397 |
| Molecular Formula | C23H24N3O2+ |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2S)-1-(2-amino-3-benzylbenzimidazol-3-ium-1-yl)-3-phenoxypropan-2-ol |
| SMILES | Nc1n(C[C@H](O)COc2ccccc2)c2ccccc2[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C23H23N3O2/c24-23-25(15-18-9-3-1-4-10-18)21-13-7-8-14-22(21)26(23)16-19(27)17-28-20-11-5-2-6-12-20/h1-14,19,24,27H,15-17H2/p+1/t19-/m0/s1 |
| InChIKey | YLKDCSKJNOKCGZ-IBGZPJMESA-O |
| XLogP | 3.00 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|