C22H30ClN3O3 — CID 44662233
1-(2-amino-3-pentylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol chloride (PubChem CID 44662233) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is 1-(2-amino-3-pentylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol chloride.
| Compound Name | 1-(2-amino-3-pentylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 44662233 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(2-amino-3-pentylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol chloride |
| SMILES | CCCCCn1c(N)[n+](CC(O)COc2ccc(OC)cc2)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C22H29N3O3.ClH/c1-3-4-7-14-24-20-8-5-6-9-21(20)25(22(24)23)15-17(26)16-28-19-12-10-18(27-2)11-13-19;/h5-6,8-13,17,23,26H,3-4,7,14-16H2,1-2H3;1H |
| InChIKey | XPZKTRGGBNZXFT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|