C19H24N3O3+ — CID 4000409
1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 4000409) has the molecular formula C19H24N3O3+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4000409 |
| Molecular Formula | C19H24N3O3+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | CCn1c(N)[n+](CC(O)COc2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H23N3O3/c1-3-21-17-6-4-5-7-18(17)22(19(21)20)12-14(23)13-25-16-10-8-15(24-2)9-11-16/h4-11,14,20,23H,3,12-13H2,1-2H3/p+1 |
| InChIKey | MVRDSGBXGSRYAA-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|