C21H27N2O2+ — CID 806319
(2R)-1-(2,3-diethylbenzimidazol-1-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol (PubChem CID 806319) has the molecular formula C21H27N2O2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is (2R)-1-(2,3-diethylbenzimidazol-1-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(2,3-diethylbenzimidazol-1-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 806319 |
| Molecular Formula | C21H27N2O2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (2R)-1-(2,3-diethylbenzimidazol-1-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol |
| SMILES | CCc1n(CC)c2ccccc2[n+]1C[C@@H](O)COc1ccc(C)cc1 |
| InChI | InChI=1S/C21H27N2O2/c1-4-21-22(5-2)19-8-6-7-9-20(19)23(21)14-17(24)15-25-18-12-10-16(3)11-13-18/h6-13,17,24H,4-5,14-15H2,1-3H3/q+1/t17-/m1/s1 |
| InChIKey | UMQLNRSCPOUJQS-QGZVFWFLSA-N |
| XLogP | 3.26 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|