C21H33N2O2+ — CID 92506280
(2S)-1-cyclohexyloxy-3-(3-ethyl-2-propylbenzimidazol-1-ium-1-yl)propan-2-ol (PubChem CID 92506280) has the molecular formula C21H33N2O2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is (2S)-1-cyclohexyloxy-3-(3-ethyl-2-propylbenzimidazol-1-ium-1-yl)propan-2-ol.
| Compound Name | (2S)-1-cyclohexyloxy-3-(3-ethyl-2-propylbenzimidazol-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 92506280 |
| Molecular Formula | C21H33N2O2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (2S)-1-cyclohexyloxy-3-(3-ethyl-2-propylbenzimidazol-1-ium-1-yl)propan-2-ol |
| SMILES | CCCc1n(CC)c2ccccc2[n+]1C[C@H](O)COC1CCCCC1 |
| InChI | InChI=1S/C21H33N2O2/c1-3-10-21-22(4-2)19-13-8-9-14-20(19)23(21)15-17(24)16-25-18-11-6-5-7-12-18/h8-9,13-14,17-18,24H,3-7,10-12,15-16H2,1-2H3/q+1/t17-/m0/s1 |
| InChIKey | UJBTTXGLMQHAKF-KRWDZBQOSA-N |
| XLogP | 3.61 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|