C12H17N2O+ — CID 3280571
(1,3-diethylbenzimidazol-3-ium-2-yl)methanol (PubChem CID 3280571) has the molecular formula C12H17N2O+ and a molecular weight of 205.28 g/mol. Its IUPAC name is (1,3-diethylbenzimidazol-3-ium-2-yl)methanol.
| Compound Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methanol |
|---|---|
| PubChem CID | 3280571 |
| Molecular Formula | C12H17N2O+ |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methanol |
| SMILES | CCn1c(CO)[n+](CC)c2ccccc21 |
| InChI | InChI=1S/C12H17N2O/c1-3-13-10-7-5-6-8-11(10)14(4-2)12(13)9-15/h5-8,15H,3-4,9H2,1-2H3/q+1 |
| InChIKey | DIAXYDOVAVIXOM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|