About benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide
benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide (PubChem CID 87323985) has the molecular formula C19H21BrN2O3
and a molecular weight of 405.29 g/mol. Its IUPAC name is benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide.
Molecular Properties
| Compound Name | benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide |
| PubChem CID | 87323985 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide |
| SMILES | CCn1c(CO)[n+](CC(=O)OCc2ccccc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C19H21N2O3.BrH/c1-2-20-16-10-6-7-11-17(16)21(18(20)13-22)12-19(23)24-14-15-8-4-3-5-9-15;/h3-11,22H,2,12-14H2,1H3;1H/q+1;/p-1 |
| InChIKey | TZKSPIMTSTXZJD-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide?
The IUPAC name of benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide (CID 87323985) is benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide.
What is the SMILES notation for benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide?
The canonical SMILES for benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide is CCn1c(CO)[n+](CC(=O)OCc2ccccc2)c2ccccc21.[Br-].
What is the InChIKey of benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide?
The InChIKey is TZKSPIMTSTXZJD-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21N2O3.BrH/c1-2-20-16-10-6-7-11-17(16)21(18(20)13-22)12-19(23)24-14-15-8-4-3-5-9-15;/h3-11,22H,2,12-14H2,1H3;1H/q+1;/p-1.
What are the key properties of benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide?
benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide has a molecular weight of 405.29 g/mol, XLogP of -0.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[3-ethyl-2-(hydroxymethyl)benzimidazol-1-ium-1-yl]acetate bromide is sourced from PubChem (CID 87323985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).