C17H17BrFN3O — CID 44656565
2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-fluorophenyl)ethanone bromide (PubChem CID 44656565) has the molecular formula C17H17BrFN3O and a molecular weight of 378.25 g/mol. Its IUPAC name is 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-fluorophenyl)ethanone bromide.
| Compound Name | 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-fluorophenyl)ethanone bromide |
|---|---|
| PubChem CID | 44656565 |
| Molecular Formula | C17H17BrFN3O |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-fluorophenyl)ethanone bromide |
| SMILES | CCn1c(N)[n+](CC(=O)c2ccc(F)cc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C17H16FN3O.BrH/c1-2-20-14-5-3-4-6-15(14)21(17(20)19)11-16(22)12-7-9-13(18)10-8-12;/h3-10,19H,2,11H2,1H3;1H |
| InChIKey | SECOIPQYVCVQOJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|