C19H18ClN2O+ — CID 5172498
2-(2-chloro-3-prop-2-enylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone (PubChem CID 5172498) has the molecular formula C19H18ClN2O+ and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-(2-chloro-3-prop-2-enylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone.
| Compound Name | 2-(2-chloro-3-prop-2-enylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 5172498 |
| Molecular Formula | C19H18ClN2O+ |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(2-chloro-3-prop-2-enylbenzimidazol-1-ium-1-yl)-1-(4-methylphenyl)ethanone |
| SMILES | C=CCn1c(Cl)[n+](CC(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H18ClN2O/c1-3-12-21-16-6-4-5-7-17(16)22(19(21)20)13-18(23)15-10-8-14(2)9-11-15/h3-11H,1,12-13H2,2H3/q+1 |
| InChIKey | RLVSSLOHOSTKOT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|