C28H32N4O2+2 — CID 122222209
(1R,2R)-1,2-bis[1,3-bis(prop-2-enyl)benzimidazol-3-ium-2-yl]ethane-1,2-diol (PubChem CID 122222209) has the molecular formula C28H32N4O2+2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1R,2R)-1,2-bis[1,3-bis(prop-2-enyl)benzimidazol-3-ium-2-yl]ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-bis[1,3-bis(prop-2-enyl)benzimidazol-3-ium-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 122222209 |
| Molecular Formula | C28H32N4O2+2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (1R,2R)-1,2-bis[1,3-bis(prop-2-enyl)benzimidazol-3-ium-2-yl]ethane-1,2-diol |
| SMILES | C=CCn1c([C@@H](O)[C@H](O)c2n(CC=C)c3ccccc3[n+]2CC=C)[n+](CC=C)c2ccccc21 |
| InChI | InChI=1S/C28H32N4O2/c1-5-17-29-21-13-9-10-14-22(21)30(18-6-2)27(29)25(33)26(34)28-31(19-7-3)23-15-11-12-16-24(23)32(28)20-8-4/h5-16,25-26,33-34H,1-4,17-20H2/q+2/t25-,26-/m0/s1 |
| InChIKey | QXWBAYLBCBFTAX-UIOOFZCWSA-N |
| XLogP | 3.68 |
| TPSA | 58.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|