C18H19BrN2 — CID 139222238
1-ethyl-2-phenyl-3-prop-2-enylbenzimidazol-3-ium bromide (PubChem CID 139222238) has the molecular formula C18H19BrN2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-ethyl-2-phenyl-3-prop-2-enylbenzimidazol-3-ium bromide.
| Compound Name | 1-ethyl-2-phenyl-3-prop-2-enylbenzimidazol-3-ium bromide |
|---|---|
| PubChem CID | 139222238 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-ethyl-2-phenyl-3-prop-2-enylbenzimidazol-3-ium bromide |
| SMILES | C=CC[n+]1c(-c2ccccc2)n(CC)c2ccccc21.[Br-] |
| InChI | InChI=1S/C18H19N2.BrH/c1-3-14-20-17-13-9-8-12-16(17)19(4-2)18(20)15-10-6-5-7-11-15;/h3,5-13H,1,4,14H2,2H3;1H/q+1;/p-1 |
| InChIKey | PIAFZRJETCQOME-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|