About prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride
prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride (PubChem CID 126958140) has the molecular formula C15H20ClN2O2+
and a molecular weight of 295.79 g/mol. Its IUPAC name is prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride |
| PubChem CID | 126958140 |
| Molecular Formula | C15H20ClN2O2+ |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride |
| SMILES | C=CCOC(=O)C[n+]1c(C)n(CC)c2ccccc21.Cl |
| InChI | InChI=1S/C15H19N2O2.ClH/c1-4-10-19-15(18)11-17-12(3)16(5-2)13-8-6-7-9-14(13)17;/h4,6-9H,1,5,10-11H2,2-3H3;1H/q+1; |
| InChIKey | ZWWWMBQXJRTPNB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride?
The IUPAC name of prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride (CID 126958140) is prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride.
What is the SMILES notation for prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride?
The canonical SMILES for prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride is C=CCOC(=O)C[n+]1c(C)n(CC)c2ccccc21.Cl.
What is the InChIKey of prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride?
The InChIKey is ZWWWMBQXJRTPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N2O2.ClH/c1-4-10-19-15(18)11-17-12(3)16(5-2)13-8-6-7-9-14(13)17;/h4,6-9H,1,5,10-11H2,2-3H3;1H/q+1;.
What are the key properties of prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride?
prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride has a molecular weight of 295.79 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)acetate;hydrochloride is sourced from PubChem (CID 126958140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).