C11H15IN2 — CID 21205372
1-ethyl-2,3-dimethylbenzimidazol-3-ium iodide (PubChem CID 21205372) has the molecular formula C11H15IN2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylbenzimidazol-3-ium iodide.
| Compound Name | 1-ethyl-2,3-dimethylbenzimidazol-3-ium iodide |
|---|---|
| PubChem CID | 21205372 |
| Molecular Formula | C11H15IN2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-ethyl-2,3-dimethylbenzimidazol-3-ium iodide |
| SMILES | CCn1c(C)[n+](C)c2ccccc21.[I-] |
| InChI | InChI=1S/C11H15N2.HI/c1-4-13-9(2)12(3)10-7-5-6-8-11(10)13;/h5-8H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KINBBYXARKSTRM-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|