C12H17N2O+ — CID 153134341
3-ethyl-5-methoxy-1,2-dimethylbenzimidazol-1-ium (PubChem CID 153134341) has the molecular formula C12H17N2O+ and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-1,2-dimethylbenzimidazol-1-ium.
| Compound Name | 3-ethyl-5-methoxy-1,2-dimethylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 153134341 |
| Molecular Formula | C12H17N2O+ |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-ethyl-5-methoxy-1,2-dimethylbenzimidazol-1-ium |
| SMILES | CCn1c(C)[n+](C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C12H17N2O/c1-5-14-9(2)13(3)11-7-6-10(15-4)8-12(11)14/h6-8H,5H2,1-4H3/q+1 |
| InChIKey | VXJGDNJDRNDUIH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|