C13H21BrClN3O2 — CID 139581107
2-[2-(aminomethyl)-3-ethyl-5-methoxybenzimidazol-1-ium-1-yl]ethanol;bromide;hydrochloride (PubChem CID 139581107) has the molecular formula C13H21BrClN3O2 and a molecular weight of 366.69 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3-ethyl-5-methoxybenzimidazol-1-ium-1-yl]ethanol;bromide;hydrochloride.
| Compound Name | 2-[2-(aminomethyl)-3-ethyl-5-methoxybenzimidazol-1-ium-1-yl]ethanol;bromide;hydrochloride |
|---|---|
| PubChem CID | 139581107 |
| Molecular Formula | C13H21BrClN3O2 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-[2-(aminomethyl)-3-ethyl-5-methoxybenzimidazol-1-ium-1-yl]ethanol;bromide;hydrochloride |
| SMILES | CCn1c(CN)[n+](CCO)c2ccc(OC)cc21.Cl.[Br-] |
| InChI | InChI=1S/C13H20N3O2.BrH.ClH/c1-3-15-12-8-10(18-2)4-5-11(12)16(6-7-17)13(15)9-14;;/h4-5,8,17H,3,6-7,9,14H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | DBCOYXJZZYZTFW-UHFFFAOYSA-M |
| XLogP | -2.17 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|