C24H26ClN6O3+ — CID 53258014
[1,3-diethyl-5-(4-methoxyphenyl)benzimidazol-1-ium-2-yl]methyl 3,5-diamino-6-chloropyrazine-2-carboxylate (PubChem CID 53258014) has the molecular formula C24H26ClN6O3+ and a molecular weight of 481.96 g/mol. Its IUPAC name is [1,3-diethyl-5-(4-methoxyphenyl)benzimidazol-1-ium-2-yl]methyl 3,5-diamino-6-chloropyrazine-2-carboxylate.
| Compound Name | [1,3-diethyl-5-(4-methoxyphenyl)benzimidazol-1-ium-2-yl]methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 53258014 |
| Molecular Formula | C24H26ClN6O3+ |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [1,3-diethyl-5-(4-methoxyphenyl)benzimidazol-1-ium-2-yl]methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
| SMILES | CCn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(-c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C24H25ClN6O3/c1-4-30-17-11-8-15(14-6-9-16(33-3)10-7-14)12-18(17)31(5-2)19(30)13-34-24(32)20-22(26)29-23(27)21(25)28-20/h6-12H,4-5,13H2,1-3H3,(H3-,26,27,29,32)/p+1 |
| InChIKey | ZMHXTZXMKIZWAW-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|