C26H38ClN10O3+ — CID 122420173
3,5-diamino-6-chloro-N-[[1,3-diethyl-5-[2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]ethoxy]benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 122420173) has the molecular formula C26H38ClN10O3+ and a molecular weight of 574.11 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[[1,3-diethyl-5-[2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]ethoxy]benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[[1,3-diethyl-5-[2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]ethoxy]benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122420173 |
| Molecular Formula | C26H38ClN10O3+ |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[[1,3-diethyl-5-[2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]ethoxy]benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(OCCNC(=O)CN3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C26H37ClN10O3/c1-4-36-18-7-6-17(40-13-8-30-20(38)16-35-11-9-34(3)10-12-35)14-19(18)37(5-2)21(36)15-31-26(39)22-24(28)33-25(29)23(27)32-22/h6-7,14H,4-5,8-13,15-16H2,1-3H3,(H5-,28,29,30,31,33,38,39)/p+1 |
| InChIKey | VXHAYGGOHJBSSR-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 160.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|