C17H21ClN7O+ — CID 53258353
3,5-diamino-6-chloro-N-[(1,3-diethylbenzimidazol-3-ium-2-yl)methyl]pyrazine-2-carboxamide (PubChem CID 53258353) has the molecular formula C17H21ClN7O+ and a molecular weight of 374.86 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(1,3-diethylbenzimidazol-3-ium-2-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[(1,3-diethylbenzimidazol-3-ium-2-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53258353 |
| Molecular Formula | C17H21ClN7O+ |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(1,3-diethylbenzimidazol-3-ium-2-yl)methyl]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccccc21 |
| InChI | InChI=1S/C17H20ClN7O/c1-3-24-10-7-5-6-8-11(10)25(4-2)12(24)9-21-17(26)13-15(19)23-16(20)14(18)22-13/h5-8H,3-4,9H2,1-2H3,(H4-,19,20,21,23,26)/p+1 |
| InChIKey | BTUYKZRRIOGPGV-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|