C18H21ClN7O3+ — CID 122420200
2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylic acid (PubChem CID 122420200) has the molecular formula C18H21ClN7O3+ and a molecular weight of 418.87 g/mol. Its IUPAC name is 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylic acid.
| Compound Name | 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 122420200 |
| Molecular Formula | C18H21ClN7O3+ |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylic acid |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C18H20ClN7O3/c1-3-25-10-6-5-9(18(28)29)7-11(10)26(4-2)12(25)8-22-17(27)13-15(20)24-16(21)14(19)23-13/h5-7H,3-4,8H2,1-2H3,(H5-,20,21,22,24,27,28,29)/p+1 |
| InChIKey | RRLSXTJIHRQMKH-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|