C19H21ClIN8O3+ — CID 154276731
2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-3-ethyl-1-methylbenzimidazol-1-ium-5-carbonyl]amino]acetyl iodide (PubChem CID 154276731) has the molecular formula C19H21ClIN8O3+ and a molecular weight of 571.79 g/mol. Its IUPAC name is 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-3-ethyl-1-methylbenzimidazol-1-ium-5-carbonyl]amino]acetyl iodide.
| Compound Name | 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-3-ethyl-1-methylbenzimidazol-1-ium-5-carbonyl]amino]acetyl iodide |
|---|---|
| PubChem CID | 154276731 |
| Molecular Formula | C19H21ClIN8O3+ |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-3-ethyl-1-methylbenzimidazol-1-ium-5-carbonyl]amino]acetyl iodide |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](C)c2ccc(C(=O)NCC(=O)I)cc21 |
| InChI | InChI=1S/C19H20ClIN8O3/c1-3-29-11-6-9(18(31)24-7-12(21)30)4-5-10(11)28(2)13(29)8-25-19(32)14-16(22)27-17(23)15(20)26-14/h4-6H,3,7-8H2,1-2H3,(H5-,22,23,24,25,27,31,32)/p+1 |
| InChIKey | HBEDEUUVIDTTGQ-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|