C22H31ClN7O5+ — CID 86582968
3,5-diamino-6-chloro-N-[[3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxybenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 86582968) has the molecular formula C22H31ClN7O5+ and a molecular weight of 508.99 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[[3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxybenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[[3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxybenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 86582968 |
| Molecular Formula | C22H31ClN7O5+ |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[[3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxybenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](CCOCCOCCO)c2ccc(OC)cc21 |
| InChI | InChI=1S/C22H30ClN7O5/c1-3-29-16-12-14(33-2)4-5-15(16)30(6-8-34-10-11-35-9-7-31)17(29)13-26-22(32)18-20(24)28-21(25)19(23)27-18/h4-5,12,31H,3,6-11,13H2,1-2H3,(H4-,24,25,26,28,32)/p+1 |
| InChIKey | FXDTWUHSWXJSSR-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|