C17H21ClIN7O2 — CID 53257354
3,5-diamino-6-chloro-N-[(1-ethyl-5-methoxy-3-methylbenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide (PubChem CID 53257354) has the molecular formula C17H21ClIN7O2 and a molecular weight of 517.76 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(1-ethyl-5-methoxy-3-methylbenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide.
| Compound Name | 3,5-diamino-6-chloro-N-[(1-ethyl-5-methoxy-3-methylbenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide |
|---|---|
| PubChem CID | 53257354 |
| Molecular Formula | C17H21ClIN7O2 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(1-ethyl-5-methoxy-3-methylbenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide |
| SMILES | CC[n+]1c(CNC(=O)c2nc(Cl)c(N)nc2N)n(C)c2cc(OC)ccc21.[I-] |
| InChI | InChI=1S/C17H20ClN7O2.HI/c1-4-25-10-6-5-9(27-3)7-11(10)24(2)12(25)8-21-17(26)13-15(19)23-16(20)14(18)22-13;/h5-7H,4,8H2,1-3H3,(H4-,19,20,21,23,26);1H |
| InChIKey | YSZVJSAXLHYOEI-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|