C26H40Cl2N9O3+ — CID 145120793
chloromethane;3,5-diamino-6-chloro-N-[[5-[2-[[2-(diethylamino)acetyl]amino]ethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 145120793) has the molecular formula C26H40Cl2N9O3+ and a molecular weight of 597.57 g/mol. Its IUPAC name is chloromethane;3,5-diamino-6-chloro-N-[[5-[2-[[2-(diethylamino)acetyl]amino]ethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | chloromethane;3,5-diamino-6-chloro-N-[[5-[2-[[2-(diethylamino)acetyl]amino]ethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145120793 |
| Molecular Formula | C26H40Cl2N9O3+ |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | chloromethane;3,5-diamino-6-chloro-N-[[5-[2-[[2-(diethylamino)acetyl]amino]ethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CCN(CC)CC(=O)NCCOc1ccc2c(c1)n(CC)c(CNC(=O)c1nc(Cl)c(N)nc1N)[n+]2CC.CCl |
| InChI | InChI=1S/C25H36ClN9O3.CH3Cl/c1-5-33(6-2)15-19(36)29-11-12-38-16-9-10-17-18(13-16)35(8-4)20(34(17)7-3)14-30-25(37)21-23(27)32-24(28)22(26)31-21;1-2/h9-10,13H,5-8,11-12,14-15H2,1-4H3,(H5-,27,28,29,30,32,36,37);1H3/p+1 |
| InChIKey | NWAVKLYKRLVSLP-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|