C23H25ClIN7O2 — CID 53258606
3,5-diamino-6-chloro-N-[(3-ethyl-1-methyl-5-phenylmethoxybenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide (PubChem CID 53258606) has the molecular formula C23H25ClIN7O2 and a molecular weight of 593.86 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(3-ethyl-1-methyl-5-phenylmethoxybenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide.
| Compound Name | 3,5-diamino-6-chloro-N-[(3-ethyl-1-methyl-5-phenylmethoxybenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide |
|---|---|
| PubChem CID | 53258606 |
| Molecular Formula | C23H25ClIN7O2 |
| Molecular Weight | 593.86 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(3-ethyl-1-methyl-5-phenylmethoxybenzimidazol-1-ium-2-yl)methyl]pyrazine-2-carboxamide iodide |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](C)c2ccc(OCc3ccccc3)cc21.[I-] |
| InChI | InChI=1S/C23H24ClN7O2.HI/c1-3-31-17-11-15(33-13-14-7-5-4-6-8-14)9-10-16(17)30(2)18(31)12-27-23(32)19-21(25)29-22(26)20(24)28-19;/h4-11H,3,12-13H2,1-2H3,(H4-,25,26,27,29,32);1H |
| InChIKey | VTASPYCTRISNHR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.86 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|