C25H25N7O4 — CID 157378789
3-amino-N-[(3-benzyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide formate (PubChem CID 157378789) has the molecular formula C25H25N7O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is 3-amino-N-[(3-benzyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide formate.
| Compound Name | 3-amino-N-[(3-benzyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide formate |
|---|---|
| PubChem CID | 157378789 |
| Molecular Formula | C25H25N7O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-amino-N-[(3-benzyl-5-methoxy-1-methylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide formate |
| SMILES | COc1ccc2c(c1)n(Cc1ccccc1)c(CNC(=O)c1nc3cc[nH]c3nc1N)[n+]2C.O=C[O-] |
| InChI | InChI=1S/C24H23N7O2.CH2O2/c1-30-18-9-8-16(33-2)12-19(18)31(14-15-6-4-3-5-7-15)20(30)13-27-24(32)21-22(25)29-23-17(28-21)10-11-26-23;2-1-3/h3-12H,13-14H2,1-2H3,(H3-,25,26,27,28,29,32);1H,(H,2,3) |
| InChIKey | BKQCFNYICQXDKP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|