C24H31N8O+ — CID 139580852
3-amino-N-[(1,3-diethyl-5-piperidin-4-ylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide (PubChem CID 139580852) has the molecular formula C24H31N8O+ and a molecular weight of 447.57 g/mol. Its IUPAC name is 3-amino-N-[(1,3-diethyl-5-piperidin-4-ylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(1,3-diethyl-5-piperidin-4-ylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 139580852 |
| Molecular Formula | C24H31N8O+ |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 3-amino-N-[(1,3-diethyl-5-piperidin-4-ylbenzimidazol-1-ium-2-yl)methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc3cc[nH]c3nc2N)[n+](CC)c2ccc(C3CCNCC3)cc21 |
| InChI | InChI=1S/C24H30N8O/c1-3-31-18-6-5-16(15-7-10-26-11-8-15)13-19(18)32(4-2)20(31)14-28-24(33)21-22(25)30-23-17(29-21)9-12-27-23/h5-6,9,12-13,15,26H,3-4,7-8,10-11,14H2,1-2H3,(H3-,25,27,28,29,30,33)/p+1 |
| InChIKey | ZFIRRQGRMPREAT-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|