C20H25ClN8O3 — CID 140663858
2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]methylamino]acetate (PubChem CID 140663858) has the molecular formula C20H25ClN8O3 and a molecular weight of 460.93 g/mol. Its IUPAC name is 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]methylamino]acetate.
| Compound Name | 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]methylamino]acetate |
|---|---|
| PubChem CID | 140663858 |
| Molecular Formula | C20H25ClN8O3 |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[[2-[[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]methylamino]acetate |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(CNCC(=O)[O-])cc21 |
| InChI | InChI=1S/C20H25ClN8O3/c1-3-28-12-6-5-11(8-24-10-15(30)31)7-13(12)29(4-2)14(28)9-25-20(32)16-18(22)27-19(23)17(21)26-16/h5-7,24H,3-4,8-10H2,1-2H3,(H5-,22,23,25,27,30,31,32) |
| InChIKey | QYAJXRYTFSHULS-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 167.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|