C25H31ClF3N7O5 — CID 161455405
3-amino-N-[[5-[2-(butylamino)-2-oxoethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]-6-chloropyrazine-2-carboxamide;2,2,2-trifluoroacetate (PubChem CID 161455405) has the molecular formula C25H31ClF3N7O5 and a molecular weight of 602.01 g/mol. Its IUPAC name is 3-amino-N-[[5-[2-(butylamino)-2-oxoethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]-6-chloropyrazine-2-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 3-amino-N-[[5-[2-(butylamino)-2-oxoethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]-6-chloropyrazine-2-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161455405 |
| Molecular Formula | C25H31ClF3N7O5 |
| Molecular Weight | 602.01 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 3-amino-N-[[5-[2-(butylamino)-2-oxoethoxy]-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]-6-chloropyrazine-2-carboxamide;2,2,2-trifluoroacetate |
| SMILES | CCCCNC(=O)COc1ccc2c(c1)n(CC)c(CNC(=O)c1nc(Cl)cnc1N)[n+]2CC.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H30ClN7O3.C2HF3O2/c1-4-7-10-26-19(32)14-34-15-8-9-16-17(11-15)31(6-3)20(30(16)5-2)13-28-23(33)21-22(25)27-12-18(24)29-21;3-2(4,5)1(6)7/h8-9,11-12H,4-7,10,13-14H2,1-3H3,(H3-,25,26,27,28,32,33);(H,6,7) |
| InChIKey | ZWEQFIZHUDKCNG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 168.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.01 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|