C27H41Cl2N8O3+ — CID 145260417
2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethyl-N-(2-morpholin-4-ylethyl)benzimidazol-1-ium-5-carboxamide;chloromethane;ethane (PubChem CID 145260417) has the molecular formula C27H41Cl2N8O3+ and a molecular weight of 596.58 g/mol. Its IUPAC name is 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethyl-N-(2-morpholin-4-ylethyl)benzimidazol-1-ium-5-carboxamide;chloromethane;ethane.
| Compound Name | 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethyl-N-(2-morpholin-4-ylethyl)benzimidazol-1-ium-5-carboxamide;chloromethane;ethane |
|---|---|
| PubChem CID | 145260417 |
| Molecular Formula | C27H41Cl2N8O3+ |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethyl-N-(2-morpholin-4-ylethyl)benzimidazol-1-ium-5-carboxamide;chloromethane;ethane |
| SMILES | CC.CCl.CCn1c(CNC(=O)c2nc(Cl)cnc2N)[n+](CC)c2ccc(C(=O)NCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C24H31ClN8O3.C2H6.CH3Cl/c1-3-32-17-6-5-16(23(34)27-7-8-31-9-11-36-12-10-31)13-18(17)33(4-2)20(32)15-29-24(35)21-22(26)28-14-19(25)30-21;2*1-2/h5-6,13-14H,3-4,7-12,15H2,1-2H3,(H3-,26,27,28,29,34,35);1-2H3;1H3/p+1 |
| InChIKey | MMCJMZPTPBHCLW-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|