C22H28ClN6O3+ — CID 126611324
tert-butyl 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate (PubChem CID 126611324) has the molecular formula C22H28ClN6O3+ and a molecular weight of 459.96 g/mol. Its IUPAC name is tert-butyl 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | tert-butyl 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 126611324 |
| Molecular Formula | C22H28ClN6O3+ |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | tert-butyl 2-[[(3-amino-6-chloropyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCn1c(CNC(=O)c2nc(Cl)cnc2N)[n+](CC)c2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C22H27ClN6O3/c1-6-28-14-9-8-13(21(31)32-22(3,4)5)10-15(14)29(7-2)17(28)12-26-20(30)18-19(24)25-11-16(23)27-18/h8-11H,6-7,12H2,1-5H3,(H2-,24,25,26,30)/p+1 |
| InChIKey | JYLBHBCGMHXXFE-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|