C20H35N4O2+ — CID 145120863
tert-butyl N-[[5-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]carbamate;ethane (PubChem CID 145120863) has the molecular formula C20H35N4O2+ and a molecular weight of 363.53 g/mol. Its IUPAC name is tert-butyl N-[[5-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[5-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 145120863 |
| Molecular Formula | C20H35N4O2+ |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl N-[[5-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-2-yl]methyl]carbamate;ethane |
| SMILES | CC.CCn1c(CNC(=O)OC(C)(C)C)[n+](CC)c2ccc(CN)cc21 |
| InChI | InChI=1S/C18H28N4O2.C2H6/c1-6-21-14-9-8-13(11-19)10-15(14)22(7-2)16(21)12-20-17(23)24-18(3,4)5;1-2/h8-10H,6-7,11-12,19H2,1-5H3;1-2H3/p+1 |
| InChIKey | RJZNEQUBMBPSPK-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|