C24H38N5O4+ — CID 122420222
tert-butyl 4-[2-(aminomethyl)-6-ethoxy-1,3-diethylbenzimidazol-1-ium-5-carbonyl]piperazine-1-carboxylate (PubChem CID 122420222) has the molecular formula C24H38N5O4+ and a molecular weight of 460.60 g/mol. Its IUPAC name is tert-butyl 4-[2-(aminomethyl)-6-ethoxy-1,3-diethylbenzimidazol-1-ium-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(aminomethyl)-6-ethoxy-1,3-diethylbenzimidazol-1-ium-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122420222 |
| Molecular Formula | C24H38N5O4+ |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | tert-butyl 4-[2-(aminomethyl)-6-ethoxy-1,3-diethylbenzimidazol-1-ium-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOc1cc2c(cc1C(=O)N1CCN(C(=O)OC(C)(C)C)CC1)n(CC)c(CN)[n+]2CC |
| InChI | InChI=1S/C24H38N5O4/c1-7-28-18-14-17(20(32-9-3)15-19(18)29(8-2)21(28)16-25)22(30)26-10-12-27(13-11-26)23(31)33-24(4,5)6/h14-15H,7-13,16,25H2,1-6H3/q+1 |
| InChIKey | SJDKLCDKKCJGIT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|