C23H38N3O3+ — CID 123351636
tert-butyl N-[2-[1,3-diethyl-2-(2-methylbutyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate (PubChem CID 123351636) has the molecular formula C23H38N3O3+ and a molecular weight of 404.58 g/mol. Its IUPAC name is tert-butyl N-[2-[1,3-diethyl-2-(2-methylbutyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1,3-diethyl-2-(2-methylbutyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 123351636 |
| Molecular Formula | C23H38N3O3+ |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | tert-butyl N-[2-[1,3-diethyl-2-(2-methylbutyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate |
| SMILES | CCC(C)Cc1n(CC)c2cc(OCCNC(=O)OC(C)(C)C)ccc2[n+]1CC |
| InChI | InChI=1S/C23H37N3O3/c1-8-17(4)15-21-25(9-2)19-12-11-18(16-20(19)26(21)10-3)28-14-13-24-22(27)29-23(5,6)7/h11-12,16-17H,8-10,13-15H2,1-7H3/p+1 |
| InChIKey | LOEWEYPSBBIYFL-UHFFFAOYSA-O |
| XLogP | 4.46 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|