C26H35BrN6O6 — CID 159166957
tert-butyl 4-[2-[[(3-amino-6-bromopyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxybutanoate formate (PubChem CID 159166957) has the molecular formula C26H35BrN6O6 and a molecular weight of 607.51 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(3-amino-6-bromopyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxybutanoate formate.
| Compound Name | tert-butyl 4-[2-[[(3-amino-6-bromopyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxybutanoate formate |
|---|---|
| PubChem CID | 159166957 |
| Molecular Formula | C26H35BrN6O6 |
| Molecular Weight | 607.51 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | tert-butyl 4-[2-[[(3-amino-6-bromopyrazine-2-carbonyl)amino]methyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxybutanoate formate |
| SMILES | CCn1c(CNC(=O)c2nc(Br)cnc2N)[n+](CC)c2ccc(OCCCC(=O)OC(C)(C)C)cc21.O=C[O-] |
| InChI | InChI=1S/C25H33BrN6O4.CH2O2/c1-6-31-17-11-10-16(35-12-8-9-21(33)36-25(3,4)5)13-18(17)32(7-2)20(31)15-29-24(34)22-23(27)28-14-19(26)30-22;2-1-3/h10-11,13-14H,6-9,12,15H2,1-5H3,(H2-,27,28,29,34);1H,(H,2,3) |
| InChIKey | KLEPGIYTNMBQHZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 165.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|