C23H38N3O5+ — CID 157315530
tert-butyl 4-[2-[2-[2-(aminomethyl)-3-ethyl-6-methoxybenzimidazol-3-ium-1-yl]ethoxy]ethoxy]butanoate (PubChem CID 157315530) has the molecular formula C23H38N3O5+ and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-(aminomethyl)-3-ethyl-6-methoxybenzimidazol-3-ium-1-yl]ethoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[2-[2-(aminomethyl)-3-ethyl-6-methoxybenzimidazol-3-ium-1-yl]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 157315530 |
| Molecular Formula | C23H38N3O5+ |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-(aminomethyl)-3-ethyl-6-methoxybenzimidazol-3-ium-1-yl]ethoxy]ethoxy]butanoate |
| SMILES | CC[n+]1c(CN)n(CCOCCOCCCC(=O)OC(C)(C)C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C23H38N3O5/c1-6-25-19-10-9-18(28-5)16-20(19)26(21(25)17-24)11-13-30-15-14-29-12-7-8-22(27)31-23(2,3)4/h9-10,16H,6-8,11-15,17,24H2,1-5H3/q+1 |
| InChIKey | BDNWCXVHKFIAEZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|