C22H36N3O3+ — CID 145120887
tert-butyl N-[2-[1,3-diethyl-2-(2-methylpropyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate (PubChem CID 145120887) has the molecular formula C22H36N3O3+ and a molecular weight of 390.55 g/mol. Its IUPAC name is tert-butyl N-[2-[1,3-diethyl-2-(2-methylpropyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1,3-diethyl-2-(2-methylpropyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 145120887 |
| Molecular Formula | C22H36N3O3+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | tert-butyl N-[2-[1,3-diethyl-2-(2-methylpropyl)benzimidazol-1-ium-5-yl]oxyethyl]carbamate |
| SMILES | CCn1c(CC(C)C)[n+](CC)c2ccc(OCCNC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C22H35N3O3/c1-8-24-18-11-10-17(27-13-12-23-21(26)28-22(5,6)7)15-19(18)25(9-2)20(24)14-16(3)4/h10-11,15-16H,8-9,12-14H2,1-7H3/p+1 |
| InChIKey | NIFXWZBTZFPWBQ-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|