C19H25NO5 — CID 122667217
tert-butyl N-[2-[6,7-bis(hydroxymethyl)naphthalen-2-yl]oxyethyl]carbamate (PubChem CID 122667217) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl N-[2-[6,7-bis(hydroxymethyl)naphthalen-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6,7-bis(hydroxymethyl)naphthalen-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 122667217 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl N-[2-[6,7-bis(hydroxymethyl)naphthalen-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2cc(CO)c(CO)cc2c1 |
| InChI | InChI=1S/C19H25NO5/c1-19(2,3)25-18(23)20-6-7-24-17-5-4-13-8-15(11-21)16(12-22)9-14(13)10-17/h4-5,8-10,21-22H,6-7,11-12H2,1-3H3,(H,20,23) |
| InChIKey | CFIUDMAHJJBMAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|