C16H21N3O3 — CID 22631368
tert-butyl N-[2-(1-aminoisoquinolin-7-yl)oxyethyl]carbamate (PubChem CID 22631368) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-[2-(1-aminoisoquinolin-7-yl)oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-aminoisoquinolin-7-yl)oxyethyl]carbamate |
|---|---|
| PubChem CID | 22631368 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl N-[2-(1-aminoisoquinolin-7-yl)oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2ccnc(N)c2c1 |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,3)22-15(20)19-8-9-21-12-5-4-11-6-7-18-14(17)13(11)10-12/h4-7,10H,8-9H2,1-3H3,(H2,17,18)(H,19,20) |
| InChIKey | QPMQRUCGGZMIFN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|