C18H22N2O5 — CID 165399886
6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]quinoline-4-carboxylic acid (PubChem CID 165399886) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]quinoline-4-carboxylic acid.
| Compound Name | 6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 165399886 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]quinoline-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc2nccc(C(=O)O)c2c1 |
| InChI | InChI=1S/C18H22N2O5/c1-18(2,3)25-17(23)20-8-4-10-24-12-5-6-15-14(11-12)13(16(21)22)7-9-19-15/h5-7,9,11H,4,8,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | GOAFYCXYTGJTLU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|