C25H31N5O5 — CID 172528178
tert-butyl N-[3-[4-[[2-(2-isocyanopyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]carbamate (PubChem CID 172528178) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[2-(2-isocyanopyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[2-(2-isocyanopyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 172528178 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | tert-butyl N-[3-[4-[[2-(2-isocyanopyrrolidin-1-yl)-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]carbamate |
| SMILES | [C-]#[N+]C1CCCN1C(=O)CNC(=O)c1ccnc2ccc(OCCCNC(=O)OC(C)(C)C)cc12 |
| InChI | InChI=1S/C25H31N5O5/c1-25(2,3)35-24(33)28-11-6-14-34-17-8-9-20-19(15-17)18(10-12-27-20)23(32)29-16-22(31)30-13-5-7-21(30)26-4/h8-10,12,15,21H,5-7,11,13-14,16H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | IDOSVZXEOYJPEA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|