C30H40N6O5 — CID 169041541
tert-butyl 4-[3-[4-[[2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate (PubChem CID 169041541) has the molecular formula C30H40N6O5 and a molecular weight of 564.69 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[[2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[[2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169041541 |
| Molecular Formula | C30H40N6O5 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | tert-butyl 4-[3-[4-[[2-[(2R)-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+][C@@H]1CCCCN1C(=O)CNC(=O)c1ccnc2ccc(OCCCN3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C30H40N6O5/c1-30(2,3)41-29(39)35-17-15-34(16-18-35)13-7-19-40-22-9-10-25-24(20-22)23(11-12-32-25)28(38)33-21-27(37)36-14-6-5-8-26(36)31-4/h9-12,20,26H,5-8,13-19,21H2,1-3H3,(H,33,38)/t26-/m0/s1 |
| InChIKey | ROFQDFQCCHWZGR-SANMLTNESA-N |
| XLogP | 3.54 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|