C33H45N7O7 — CID 171591200
6-[3-[4-[3-[2-(2-acetamidoethoxy)ethoxy]propanoyl]piperazin-1-yl]propoxy]-N-[2-[(2R)-2-isocyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 171591200) has the molecular formula C33H45N7O7 and a molecular weight of 651.77 g/mol. Its IUPAC name is 6-[3-[4-[3-[2-(2-acetamidoethoxy)ethoxy]propanoyl]piperazin-1-yl]propoxy]-N-[2-[(2R)-2-isocyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | 6-[3-[4-[3-[2-(2-acetamidoethoxy)ethoxy]propanoyl]piperazin-1-yl]propoxy]-N-[2-[(2R)-2-isocyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 171591200 |
| Molecular Formula | C33H45N7O7 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 6-[3-[4-[3-[2-(2-acetamidoethoxy)ethoxy]propanoyl]piperazin-1-yl]propoxy]-N-[2-[(2R)-2-isocyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | [C-]#[N+][C@@H]1CCCN1C(=O)CNC(=O)c1ccnc2ccc(OCCCN3CCN(C(=O)CCOCCOCCNC(C)=O)CC3)cc12 |
| InChI | InChI=1S/C33H45N7O7/c1-25(41)35-11-20-46-22-21-45-19-9-31(42)39-16-14-38(15-17-39)12-4-18-47-26-6-7-29-28(23-26)27(8-10-36-29)33(44)37-24-32(43)40-13-3-5-30(40)34-2/h6-8,10,23,30H,3-5,9,11-22,24H2,1H3,(H,35,41)(H,37,44)/t30-/m0/s1 |
| InChIKey | MWKCBFFHBRQHGS-PMERELPUSA-N |
| XLogP | 1.30 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|