C24H29N3O5 — CID 170238094
N-[2-oxo-2-[2-(2-oxopropanoyl)pyrrolidin-1-yl]ethyl]-7-pentoxyquinoline-4-carboxamide (PubChem CID 170238094) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[2-oxo-2-[2-(2-oxopropanoyl)pyrrolidin-1-yl]ethyl]-7-pentoxyquinoline-4-carboxamide.
| Compound Name | N-[2-oxo-2-[2-(2-oxopropanoyl)pyrrolidin-1-yl]ethyl]-7-pentoxyquinoline-4-carboxamide |
|---|---|
| PubChem CID | 170238094 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[2-oxo-2-[2-(2-oxopropanoyl)pyrrolidin-1-yl]ethyl]-7-pentoxyquinoline-4-carboxamide |
| SMILES | CCCCCOc1ccc2c(C(=O)NCC(=O)N3CCCC3C(=O)C(C)=O)ccnc2c1 |
| InChI | InChI=1S/C24H29N3O5/c1-3-4-5-13-32-17-8-9-18-19(10-11-25-20(18)14-17)24(31)26-15-22(29)27-12-6-7-21(27)23(30)16(2)28/h8-11,14,21H,3-7,12-13,15H2,1-2H3,(H,26,31) |
| InChIKey | LQKGIESKVCDJCU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|