C25H23FN4O4 — CID 164623687
N-[2-[(2S)-2-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 164623687) has the molecular formula C25H23FN4O4 and a molecular weight of 462.48 g/mol. Its IUPAC name is N-[2-[(2S)-2-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | N-[2-[(2S)-2-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 164623687 |
| Molecular Formula | C25H23FN4O4 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[2-[(2S)-2-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C25H23FN4O4/c26-17-9-7-16(8-10-17)14-28-25(34)23(32)21-6-3-13-30(21)22(31)15-29-24(33)19-11-12-27-20-5-2-1-4-18(19)20/h1-2,4-5,7-12,21H,3,6,13-15H2,(H,28,34)(H,29,33)/t21-/m0/s1 |
| InChIKey | QMQRTHDFJIGKOK-NRFANRHFSA-N |
| XLogP | 1.98 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|