C18H22N2O4 — CID 174250162
tert-butyl 2-[(7-ethoxyquinoline-4-carbonyl)amino]acetate (PubChem CID 174250162) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl 2-[(7-ethoxyquinoline-4-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(7-ethoxyquinoline-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 174250162 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl 2-[(7-ethoxyquinoline-4-carbonyl)amino]acetate |
| SMILES | CCOc1ccc2c(C(=O)NCC(=O)OC(C)(C)C)ccnc2c1 |
| InChI | InChI=1S/C18H22N2O4/c1-5-23-12-6-7-13-14(8-9-19-15(13)10-12)17(22)20-11-16(21)24-18(2,3)4/h6-10H,5,11H2,1-4H3,(H,20,22) |
| InChIKey | GDZGGJGDHGDXSU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |