C20H21N5O5 — CID 166485702
tert-butyl 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate (PubChem CID 166485702) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is tert-butyl 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate.
| Compound Name | tert-butyl 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 166485702 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | tert-butyl 1-[4-[(2-methoxy-2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)CNC(=O)c1ccnc2ccc(-n3cc(C(=O)OC(C)(C)C)nn3)cc12 |
| InChI | InChI=1S/C20H21N5O5/c1-20(2,3)30-19(28)16-11-25(24-23-16)12-5-6-15-14(9-12)13(7-8-21-15)18(27)22-10-17(26)29-4/h5-9,11H,10H2,1-4H3,(H,22,27) |
| InChIKey | PDEKDJVIQQDVFX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |