C23H25N9O3 — CID 166485817
6-[4-(3-aminopropylcarbamoyl)triazol-1-yl]-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 166485817) has the molecular formula C23H25N9O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 6-[4-(3-aminopropylcarbamoyl)triazol-1-yl]-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | 6-[4-(3-aminopropylcarbamoyl)triazol-1-yl]-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 166485817 |
| Molecular Formula | C23H25N9O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 6-[4-(3-aminopropylcarbamoyl)triazol-1-yl]-N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC(=O)c1ccnc2ccc(-n3cc(C(=O)NCCCN)nn3)cc12 |
| InChI | InChI=1S/C23H25N9O3/c24-7-2-8-27-23(35)20-14-32(30-29-20)15-4-5-19-18(11-15)17(6-9-26-19)22(34)28-13-21(33)31-10-1-3-16(31)12-25/h4-6,9,11,14,16H,1-3,7-8,10,13,24H2,(H,27,35)(H,28,34)/t16-/m0/s1 |
| InChIKey | LXPFDEYKENAXQE-INIZCTEOSA-N |
| XLogP | 0.14 |
| TPSA | 171.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|