C21H23N5O3 — CID 170151832
N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-6-morpholin-4-ylquinoline-4-carboxamide (PubChem CID 170151832) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-6-morpholin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-6-morpholin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 170151832 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]-6-morpholin-4-ylquinoline-4-carboxamide |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC(=O)c1ccnc2ccc(N3CCOCC3)cc12 |
| InChI | InChI=1S/C21H23N5O3/c22-13-16-2-1-7-26(16)20(27)14-24-21(28)17-5-6-23-19-4-3-15(12-18(17)19)25-8-10-29-11-9-25/h3-6,12,16H,1-2,7-11,14H2,(H,24,28)/t16-/m0/s1 |
| InChIKey | BDAONSUSEDEYGF-INIZCTEOSA-N |
| XLogP | 1.32 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |