C17H17F3N2O3 — CID 170539767
tert-butyl 2-[[7-(trifluoromethyl)quinoline-4-carbonyl]amino]acetate (PubChem CID 170539767) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is tert-butyl 2-[[7-(trifluoromethyl)quinoline-4-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[7-(trifluoromethyl)quinoline-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 170539767 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | tert-butyl 2-[[7-(trifluoromethyl)quinoline-4-carbonyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)c1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H17F3N2O3/c1-16(2,3)25-14(23)9-22-15(24)12-6-7-21-13-8-10(17(18,19)20)4-5-11(12)13/h4-8H,9H2,1-3H3,(H,22,24) |
| InChIKey | WTLGDQRORZXHEC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |